C13H20N2O3 — CID 170212798
1-[(2R,4S)-5,5-diethyl-4-methyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 170212798) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 1-[(2R,4S)-5,5-diethyl-4-methyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S)-5,5-diethyl-4-methyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 170212798 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 1-[(2R,4S)-5,5-diethyl-4-methyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CCC1(CC)O[C@@H](n2ccc(=O)[nH]c2=O)C[C@@H]1C |
| InChI | InChI=1S/C13H20N2O3/c1-4-13(5-2)9(3)8-11(18-13)15-7-6-10(16)14-12(15)17/h6-7,9,11H,4-5,8H2,1-3H3,(H,14,16,17)/t9-,11+/m0/s1 |
| InChIKey | UWSPFHXAHGHDMT-GXSJLCMTSA-N |
| XLogP | 1.65 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |