C35H39F3N2O11S2Si — CID 89154910
[(2S,3S,4S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-3-methoxy-4-(trifluoromethylsulfonyloxy)oxolan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 89154910) has the molecular formula C35H39F3N2O11S2Si and a molecular weight of 812.91 g/mol. Its IUPAC name is [(2S,3S,4S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-3-methoxy-4-(trifluoromethylsulfonyloxy)oxolan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,3S,4S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-3-methoxy-4-(trifluoromethylsulfonyloxy)oxolan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 89154910 |
| Molecular Formula | C35H39F3N2O11S2Si |
| Molecular Weight | 812.91 g/mol |
| Exact Mass | 812.17 |
| IUPAC Name | [(2S,3S,4S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-3-methoxy-4-(trifluoromethylsulfonyloxy)oxolan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CO[C@H]1[C@H](OS(=O)(=O)C(F)(F)F)[C@H](n2ccc(=O)[nH]c2=O)O[C@@]1(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C35H39F3N2O11S2Si/c1-24-16-18-25(19-17-24)52(43,44)48-22-34(23-49-54(33(2,3)4,26-12-8-6-9-13-26)27-14-10-7-11-15-27)30(47-5)29(51-53(45,46)35(36,37)38)31(50-34)40-21-20-28(41)39-32(40)42/h6-21,29-31H,22-23H2,1-5H3,(H,39,41,42)/t29-,30-,31+,34+/m0/s1 |
| InChIKey | MASJACVWOUFBFI-JIAKNCRUSA-N |
| XLogP | 3.34 |
| TPSA | 169.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.91 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|