C21H25F3N2O13S3 — CID 10974383
[(2R,3S,4S)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-5,5-bis(methylsulfonyloxymethyl)-4-phenylmethoxyoxolan-3-yl] trifluoromethanesulfonate (PubChem CID 10974383) has the molecular formula C21H25F3N2O13S3 and a molecular weight of 666.63 g/mol. Its IUPAC name is [(2R,3S,4S)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-5,5-bis(methylsulfonyloxymethyl)-4-phenylmethoxyoxolan-3-yl] trifluoromethanesulfonate.
| Compound Name | [(2R,3S,4S)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-5,5-bis(methylsulfonyloxymethyl)-4-phenylmethoxyoxolan-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10974383 |
| Molecular Formula | C21H25F3N2O13S3 |
| Molecular Weight | 666.63 g/mol |
| Exact Mass | 666.05 |
| IUPAC Name | [(2R,3S,4S)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-5,5-bis(methylsulfonyloxymethyl)-4-phenylmethoxyoxolan-3-yl] trifluoromethanesulfonate |
| SMILES | Cc1cn([C@@H]2OC(COS(C)(=O)=O)(COS(C)(=O)=O)[C@@H](OCc3ccccc3)[C@@H]2OS(=O)(=O)C(F)(F)F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H25F3N2O13S3/c1-13-9-26(19(28)25-17(13)27)18-15(39-42(33,34)21(22,23)24)16(35-10-14-7-5-4-6-8-14)20(38-18,11-36-40(2,29)30)12-37-41(3,31)32/h4-9,15-16,18H,10-12H2,1-3H3,(H,25,27,28)/t15-,16-,18+/m0/s1 |
| InChIKey | ODEPBWGSLLPTNG-XYJFISCASA-N |
| XLogP | -0.11 |
| TPSA | 203.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.63 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|