C22H28N2O12S2 — CID 175155742
[(2S,3R,4S)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-5,5-bis(methylsulfonyloxymethyl)-4-phenylmethoxyoxolan-3-yl] acetate (PubChem CID 175155742) has the molecular formula C22H28N2O12S2 and a molecular weight of 576.60 g/mol. Its IUPAC name is [(2S,3R,4S)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-5,5-bis(methylsulfonyloxymethyl)-4-phenylmethoxyoxolan-3-yl] acetate.
| Compound Name | [(2S,3R,4S)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-5,5-bis(methylsulfonyloxymethyl)-4-phenylmethoxyoxolan-3-yl] acetate |
|---|---|
| PubChem CID | 175155742 |
| Molecular Formula | C22H28N2O12S2 |
| Molecular Weight | 576.60 g/mol |
| Exact Mass | 576.11 |
| IUPAC Name | [(2S,3R,4S)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-5,5-bis(methylsulfonyloxymethyl)-4-phenylmethoxyoxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](n2cc(C)c(=O)[nH]c2=O)OC(COS(C)(=O)=O)(COS(C)(=O)=O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H28N2O12S2/c1-14-10-24(21(27)23-19(14)26)20-17(35-15(2)25)18(32-11-16-8-6-5-7-9-16)22(36-20,12-33-37(3,28)29)13-34-38(4,30)31/h5-10,17-18,20H,11-13H2,1-4H3,(H,23,26,27)/t17-,18+,20+/m1/s1 |
| InChIKey | KQYCWEFAOAPBNM-HBFSDRIKSA-N |
| XLogP | -0.42 |
| TPSA | 186.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.60 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|