C22H28N2O11S3 — CID 10940958
S-[(2R,3R,4R)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-5,5-bis(methylsulfonyloxymethyl)-4-phenylmethoxyoxolan-3-yl] ethanethioate (PubChem CID 10940958) has the molecular formula C22H28N2O11S3 and a molecular weight of 592.67 g/mol. Its IUPAC name is S-[(2R,3R,4R)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-5,5-bis(methylsulfonyloxymethyl)-4-phenylmethoxyoxolan-3-yl] ethanethioate.
| Compound Name | S-[(2R,3R,4R)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-5,5-bis(methylsulfonyloxymethyl)-4-phenylmethoxyoxolan-3-yl] ethanethioate |
|---|---|
| PubChem CID | 10940958 |
| Molecular Formula | C22H28N2O11S3 |
| Molecular Weight | 592.67 g/mol |
| Exact Mass | 592.09 |
| IUPAC Name | S-[(2R,3R,4R)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-5,5-bis(methylsulfonyloxymethyl)-4-phenylmethoxyoxolan-3-yl] ethanethioate |
| SMILES | CC(=O)S[C@H]1[C@H](n2cc(C)c(=O)[nH]c2=O)OC(COS(C)(=O)=O)(COS(C)(=O)=O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H28N2O11S3/c1-14-10-24(21(27)23-19(14)26)20-17(36-15(2)25)18(32-11-16-8-6-5-7-9-16)22(35-20,12-33-37(3,28)29)13-34-38(4,30)31/h5-10,17-18,20H,11-13H2,1-4H3,(H,23,26,27)/t17-,18+,20-/m1/s1 |
| InChIKey | HVWVHRNLRYXNPR-WSTZPKSXSA-N |
| XLogP | 0.30 |
| TPSA | 177.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.67 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|