C33H31N3O9 — CID 56930951
2-[(2R,3R,4S,5R)-5-(hydroxymethyl)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl]oxyisoindole-1,3-dione (PubChem CID 56930951) has the molecular formula C33H31N3O9 and a molecular weight of 613.62 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5R)-5-(hydroxymethyl)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl]oxyisoindole-1,3-dione.
| Compound Name | 2-[(2R,3R,4S,5R)-5-(hydroxymethyl)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl]oxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 56930951 |
| Molecular Formula | C33H31N3O9 |
| Molecular Weight | 613.62 g/mol |
| Exact Mass | 613.21 |
| IUPAC Name | 2-[(2R,3R,4S,5R)-5-(hydroxymethyl)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl]oxyisoindole-1,3-dione |
| SMILES | Cc1cn([C@@H]2O[C@](CO)(COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H]2ON2C(=O)c3ccccc3C2=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C33H31N3O9/c1-21-16-35(32(41)34-28(21)38)31-26(45-36-29(39)24-14-8-9-15-25(24)30(36)40)27(43-18-23-12-6-3-7-13-23)33(19-37,44-31)20-42-17-22-10-4-2-5-11-22/h2-16,26-27,31,37H,17-20H2,1H3,(H,34,38,41)/t26-,27+,31-,33-/m1/s1 |
| InChIKey | OTXGVYSCUOKVMN-KXOGATPXSA-N |
| XLogP | 2.50 |
| TPSA | 149.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.62 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|