C33H35N3O6 — CID 101491642
5-methyl-1-[(1R,3R,5R,7S)-7-phenylmethoxy-5-(phenylmethoxyamino)-1-(phenylmethoxymethyl)-2-oxabicyclo[2.2.1]heptan-3-yl]pyrimidine-2,4-dione (PubChem CID 101491642) has the molecular formula C33H35N3O6 and a molecular weight of 569.66 g/mol. Its IUPAC name is 5-methyl-1-[(1R,3R,5R,7S)-7-phenylmethoxy-5-(phenylmethoxyamino)-1-(phenylmethoxymethyl)-2-oxabicyclo[2.2.1]heptan-3-yl]pyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-[(1R,3R,5R,7S)-7-phenylmethoxy-5-(phenylmethoxyamino)-1-(phenylmethoxymethyl)-2-oxabicyclo[2.2.1]heptan-3-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 101491642 |
| Molecular Formula | C33H35N3O6 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | 5-methyl-1-[(1R,3R,5R,7S)-7-phenylmethoxy-5-(phenylmethoxyamino)-1-(phenylmethoxymethyl)-2-oxabicyclo[2.2.1]heptan-3-yl]pyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2O[C@@]3(COCc4ccccc4)CC(NOCc4ccccc4)C2[C@@H]3OCc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C33H35N3O6/c1-23-18-36(32(38)34-30(23)37)31-28-27(35-41-21-26-15-9-4-10-16-26)17-33(42-31,22-39-19-24-11-5-2-6-12-24)29(28)40-20-25-13-7-3-8-14-25/h2-16,18,27-29,31,35H,17,19-22H2,1H3,(H,34,37,38)/t27?,28?,29-,31+,33+/m0/s1 |
| InChIKey | JTDWONXVAPMTIP-KBJYZLQTSA-N |
| XLogP | 4.02 |
| TPSA | 103.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|