C25H27N3O8 — CID 56930953
(2R,3S,4R,5R)-4-aminooxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-phenylmethoxy-2-(phenylmethoxymethyl)oxolane-2-carboxylic acid (PubChem CID 56930953) has the molecular formula C25H27N3O8 and a molecular weight of 497.50 g/mol. Its IUPAC name is (2R,3S,4R,5R)-4-aminooxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-phenylmethoxy-2-(phenylmethoxymethyl)oxolane-2-carboxylic acid.
| Compound Name | (2R,3S,4R,5R)-4-aminooxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-phenylmethoxy-2-(phenylmethoxymethyl)oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 56930953 |
| Molecular Formula | C25H27N3O8 |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | (2R,3S,4R,5R)-4-aminooxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-phenylmethoxy-2-(phenylmethoxymethyl)oxolane-2-carboxylic acid |
| SMILES | Cc1cn([C@@H]2O[C@@](COCc3ccccc3)(C(=O)O)[C@@H](OCc3ccccc3)[C@H]2ON)c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H27N3O8/c1-16-12-28(24(32)27-21(16)29)22-19(36-26)20(34-14-18-10-6-3-7-11-18)25(35-22,23(30)31)15-33-13-17-8-4-2-5-9-17/h2-12,19-20,22H,13-15,26H2,1H3,(H,30,31)(H,27,29,32)/t19-,20+,22-,25-/m1/s1 |
| InChIKey | UNPRLWWEUDTDRM-BVVSVSJTSA-N |
| XLogP | 1.26 |
| TPSA | 155.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|