C22H28N2O5S — CID 88542484
[(2R,3S)-5,5-diethyl-2-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)-4-phenylmethoxyoxolan-3-yl] acetate (PubChem CID 88542484) has the molecular formula C22H28N2O5S and a molecular weight of 432.54 g/mol. Its IUPAC name is [(2R,3S)-5,5-diethyl-2-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)-4-phenylmethoxyoxolan-3-yl] acetate.
| Compound Name | [(2R,3S)-5,5-diethyl-2-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)-4-phenylmethoxyoxolan-3-yl] acetate |
|---|---|
| PubChem CID | 88542484 |
| Molecular Formula | C22H28N2O5S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [(2R,3S)-5,5-diethyl-2-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)-4-phenylmethoxyoxolan-3-yl] acetate |
| SMILES | CCC1(CC)O[C@@H](n2cc(C)c(=O)[nH]c2=S)[C@@H](OC(C)=O)C1OCc1ccccc1 |
| InChI | InChI=1S/C22H28N2O5S/c1-5-22(6-2)18(27-13-16-10-8-7-9-11-16)17(28-15(4)25)20(29-22)24-12-14(3)19(26)23-21(24)30/h7-12,17-18,20H,5-6,13H2,1-4H3,(H,23,26,30)/t17-,18?,20+/m0/s1 |
| InChIKey | XEYMSOIYBXTQPO-NKUTVCTDSA-N |
| XLogP | 3.82 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|