C21H22N2O9 — CID 11123163
[(2R,3R,4S,5R)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-5-[(4R)-2-oxo-1,3-dioxolan-4-yl]-4-phenylmethoxyoxolan-3-yl] acetate (PubChem CID 11123163) has the molecular formula C21H22N2O9 and a molecular weight of 446.41 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-5-[(4R)-2-oxo-1,3-dioxolan-4-yl]-4-phenylmethoxyoxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-5-[(4R)-2-oxo-1,3-dioxolan-4-yl]-4-phenylmethoxyoxolan-3-yl] acetate |
|---|---|
| PubChem CID | 11123163 |
| Molecular Formula | C21H22N2O9 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | [(2R,3R,4S,5R)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-5-[(4R)-2-oxo-1,3-dioxolan-4-yl]-4-phenylmethoxyoxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OCc2ccccc2)[C@@H]([C@H]2COC(=O)O2)O[C@H]1n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H22N2O9/c1-11-8-23(20(26)22-18(11)25)19-17(30-12(2)24)16(28-9-13-6-4-3-5-7-13)15(32-19)14-10-29-21(27)31-14/h3-8,14-17,19H,9-10H2,1-2H3,(H,22,25,26)/t14-,15-,16+,17-,19-/m1/s1 |
| InChIKey | VITCBSUDJLTJMB-OGJJZOIMSA-N |
| XLogP | 0.79 |
| TPSA | 135.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |