C16H20N2O9 — CID 102246922
[(3R,4R,5R,6R)-4,5-diacetyloxy-6-(5-methyl-2,4-dioxopyrimidin-1-yl)oxan-3-yl] acetate (PubChem CID 102246922) has the molecular formula C16H20N2O9 and a molecular weight of 384.34 g/mol. Its IUPAC name is [(3R,4R,5R,6R)-4,5-diacetyloxy-6-(5-methyl-2,4-dioxopyrimidin-1-yl)oxan-3-yl] acetate.
| Compound Name | [(3R,4R,5R,6R)-4,5-diacetyloxy-6-(5-methyl-2,4-dioxopyrimidin-1-yl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 102246922 |
| Molecular Formula | C16H20N2O9 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | [(3R,4R,5R,6R)-4,5-diacetyloxy-6-(5-methyl-2,4-dioxopyrimidin-1-yl)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@H](OC(C)=O)CO[C@H]1n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H20N2O9/c1-7-5-18(16(23)17-14(7)22)15-13(27-10(4)21)12(26-9(3)20)11(6-24-15)25-8(2)19/h5,11-13,15H,6H2,1-4H3,(H,17,22,23)/t11-,12-,13-,15-/m1/s1 |
| InChIKey | SFNNUUMQQFNTBT-RGCMKSIDSA-N |
| XLogP | -0.83 |
| TPSA | 142.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|