C12H14N2O5 — CID 14079555
[(3S,6S)-6-(5-methyl-2,4-dioxopyrimidin-1-yl)-3,6-dihydro-2H-pyran-3-yl] acetate (PubChem CID 14079555) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is [(3S,6S)-6-(5-methyl-2,4-dioxopyrimidin-1-yl)-3,6-dihydro-2H-pyran-3-yl] acetate.
| Compound Name | [(3S,6S)-6-(5-methyl-2,4-dioxopyrimidin-1-yl)-3,6-dihydro-2H-pyran-3-yl] acetate |
|---|---|
| PubChem CID | 14079555 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | [(3S,6S)-6-(5-methyl-2,4-dioxopyrimidin-1-yl)-3,6-dihydro-2H-pyran-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C[C@@H](n2cc(C)c(=O)[nH]c2=O)OC1 |
| InChI | InChI=1S/C12H14N2O5/c1-7-5-14(12(17)13-11(7)16)10-4-3-9(6-18-10)19-8(2)15/h3-5,9-10H,6H2,1-2H3,(H,13,16,17)/t9-,10-/m0/s1 |
| InChIKey | IVWOOWZVTDMTLM-UWVGGRQHSA-N |
| XLogP | -0.14 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|