C15H17N5O6 — CID 24796585
[(3R,5R,6R,7S)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-4,8-dioxa-1,12,13-triazatricyclo[8.3.0.03,7]trideca-10,12-dien-6-yl] acetate (PubChem CID 24796585) has the molecular formula C15H17N5O6 and a molecular weight of 363.33 g/mol. Its IUPAC name is [(3R,5R,6R,7S)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-4,8-dioxa-1,12,13-triazatricyclo[8.3.0.03,7]trideca-10,12-dien-6-yl] acetate.
| Compound Name | [(3R,5R,6R,7S)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-4,8-dioxa-1,12,13-triazatricyclo[8.3.0.03,7]trideca-10,12-dien-6-yl] acetate |
|---|---|
| PubChem CID | 24796585 |
| Molecular Formula | C15H17N5O6 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | [(3R,5R,6R,7S)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-4,8-dioxa-1,12,13-triazatricyclo[8.3.0.03,7]trideca-10,12-dien-6-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H]2OCc3cnnn3C[C@H]2O[C@H]1n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H17N5O6/c1-7-4-19(15(23)17-13(7)22)14-12(25-8(2)21)11-10(26-14)5-20-9(6-24-11)3-16-18-20/h3-4,10-12,14H,5-6H2,1-2H3,(H,17,22,23)/t10-,11+,12-,14-/m1/s1 |
| InChIKey | OJGYERJUDUNWRW-GFQSEFKGSA-N |
| XLogP | -1.14 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |