C18H26N6O8 — CID 139122475
1-[(2R,3R,4R)-3-amino-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 139122475) has the molecular formula C18H26N6O8 and a molecular weight of 454.44 g/mol. Its IUPAC name is 1-[(2R,3R,4R)-3-amino-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R)-3-amino-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139122475 |
| Molecular Formula | C18H26N6O8 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 1-[(2R,3R,4R)-3-amino-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2OC[C@H](O)[C@H]2N)c(=O)[nH]c1=O.Cc1cn([C@@H]2OC[C@H](O)[C@H]2N)c(=O)[nH]c1=O |
| InChI | InChI=1S/2C9H13N3O4/c2*1-4-2-12(9(15)11-7(4)14)8-6(10)5(13)3-16-8/h2*2,5-6,8,13H,3,10H2,1H3,(H,11,14,15)/t2*5-,6+,8+/m00/s1 |
| InChIKey | CCSJPSHRZBTCFK-XJSQPNRTSA-N |
| XLogP | -3.88 |
| TPSA | 220.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |