C16H18N2O4 — CID 54768279
5-methyl-1-[(2R,4R)-4-phenylmethoxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 54768279) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 5-methyl-1-[(2R,4R)-4-phenylmethoxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-[(2R,4R)-4-phenylmethoxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 54768279 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 5-methyl-1-[(2R,4R)-4-phenylmethoxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@@H](OCc3ccccc3)CO2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H18N2O4/c1-11-8-18(16(20)17-15(11)19)14-7-13(10-22-14)21-9-12-5-3-2-4-6-12/h2-6,8,13-14H,7,9-10H2,1H3,(H,17,19,20)/t13-,14-/m1/s1 |
| InChIKey | CAHMEZRWUHGMSO-ZIAGYGMSSA-N |
| XLogP | 1.35 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |