C30H44N3O10P — CID 122667164
bis(3-methylbutyl) (2S)-2-[[[(3R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxymethyl-phenoxyphosphoryl]amino]butanedioate (PubChem CID 122667164) has the molecular formula C30H44N3O10P and a molecular weight of 637.67 g/mol. Its IUPAC name is bis(3-methylbutyl) (2S)-2-[[[(3R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxymethyl-phenoxyphosphoryl]amino]butanedioate.
| Compound Name | bis(3-methylbutyl) (2S)-2-[[[(3R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxymethyl-phenoxyphosphoryl]amino]butanedioate |
|---|---|
| PubChem CID | 122667164 |
| Molecular Formula | C30H44N3O10P |
| Molecular Weight | 637.67 g/mol |
| Exact Mass | 637.28 |
| IUPAC Name | bis(3-methylbutyl) (2S)-2-[[[(3R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxymethyl-phenoxyphosphoryl]amino]butanedioate |
| SMILES | Cc1cn(C2C[C@@H](OCP(=O)(N[C@@H](CC(=O)OCCC(C)C)C(=O)OCCC(C)C)Oc3ccccc3)CO2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C30H44N3O10P/c1-20(2)11-13-39-27(34)16-25(29(36)40-14-12-21(3)4)32-44(38,43-23-9-7-6-8-10-23)19-42-24-15-26(41-18-24)33-17-22(5)28(35)31-30(33)37/h6-10,17,20-21,24-26H,11-16,18-19H2,1-5H3,(H,32,38)(H,31,35,37)/t24-,25+,26?,44?/m1/s1 |
| InChIKey | FGEIJQKVSXQHOO-JSVDYNEASA-N |
| XLogP | 3.91 |
| TPSA | 164.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.67 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|