C23H32N3O9P — CID 25260763
butyl 2-[[[(2R,4R)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methoxy-(4-methylphenoxy)phosphoryl]amino]propanoate (PubChem CID 25260763) has the molecular formula C23H32N3O9P and a molecular weight of 525.50 g/mol. Its IUPAC name is butyl 2-[[[(2R,4R)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methoxy-(4-methylphenoxy)phosphoryl]amino]propanoate.
| Compound Name | butyl 2-[[[(2R,4R)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methoxy-(4-methylphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 25260763 |
| Molecular Formula | C23H32N3O9P |
| Molecular Weight | 525.50 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | butyl 2-[[[(2R,4R)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methoxy-(4-methylphenoxy)phosphoryl]amino]propanoate |
| SMILES | CCCCOC(=O)C(C)NP(=O)(OC[C@@H]1OC[C@H](n2cc(C)c(=O)[nH]c2=O)O1)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C23H32N3O9P/c1-5-6-11-31-22(28)17(4)25-36(30,35-18-9-7-15(2)8-10-18)33-14-20-32-13-19(34-20)26-12-16(3)21(27)24-23(26)29/h7-10,12,17,19-20H,5-6,11,13-14H2,1-4H3,(H,25,30)(H,24,27,29)/t17?,19-,20-,36?/m1/s1 |
| InChIKey | CNUPGLLOVLGLLZ-JEMLXITRSA-N |
| XLogP | 2.55 |
| TPSA | 147.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.50 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|