C28H32N3O8P — CID 100930246
3-phenylpropyl 2-[[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 100930246) has the molecular formula C28H32N3O8P and a molecular weight of 569.55 g/mol. Its IUPAC name is 3-phenylpropyl 2-[[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 3-phenylpropyl 2-[[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 100930246 |
| Molecular Formula | C28H32N3O8P |
| Molecular Weight | 569.55 g/mol |
| Exact Mass | 569.19 |
| IUPAC Name | 3-phenylpropyl 2-[[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | Cc1cn([C@H]2C=C[C@@H](COP(=O)(NC(C)C(=O)OCCCc3ccccc3)Oc3ccccc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C28H32N3O8P/c1-20-18-31(28(34)29-26(20)32)25-16-15-24(38-25)19-37-40(35,39-23-13-7-4-8-14-23)30-21(2)27(33)36-17-9-12-22-10-5-3-6-11-22/h3-8,10-11,13-16,18,21,24-25H,9,12,17,19H2,1-2H3,(H,30,35)(H,29,32,34)/t21?,24-,25+,40?/m0/s1 |
| InChIKey | BCSIKWCIVBYRTN-SYVHHANASA-N |
| XLogP | 3.66 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|