C19H20BrIN3O8P — CID 171628855
methyl (2S)-2-[[(4-bromophenoxy)-[[(2S,5R)-5-(5-iodo-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy]phosphoryl]amino]propanoate (PubChem CID 171628855) has the molecular formula C19H20BrIN3O8P and a molecular weight of 656.16 g/mol. Its IUPAC name is methyl (2S)-2-[[(4-bromophenoxy)-[[(2S,5R)-5-(5-iodo-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy]phosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[(4-bromophenoxy)-[[(2S,5R)-5-(5-iodo-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 171628855 |
| Molecular Formula | C19H20BrIN3O8P |
| Molecular Weight | 656.16 g/mol |
| Exact Mass | 654.92 |
| IUPAC Name | methyl (2S)-2-[[(4-bromophenoxy)-[[(2S,5R)-5-(5-iodo-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy]phosphoryl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NP(=O)(OC[C@@H]1C=C[C@H](n2cc(I)c(=O)[nH]c2=O)O1)Oc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H20BrIN3O8P/c1-11(18(26)29-2)23-33(28,32-13-5-3-12(20)4-6-13)30-10-14-7-8-16(31-14)24-9-15(21)17(25)22-19(24)27/h3-9,11,14,16H,10H2,1-2H3,(H,23,28)(H,22,25,27)/t11-,14-,16+,33?/m0/s1 |
| InChIKey | HLOSDNMJAFRUJA-VAVAGYOZSA-N |
| XLogP | 2.71 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.16 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|