C22H26N3O9P — CID 23277438
methyl 2-[[(4-acetylphenoxy)-[[5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy]phosphoryl]amino]propanoate (PubChem CID 23277438) has the molecular formula C22H26N3O9P and a molecular weight of 507.44 g/mol. Its IUPAC name is methyl 2-[[(4-acetylphenoxy)-[[5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy]phosphoryl]amino]propanoate.
| Compound Name | methyl 2-[[(4-acetylphenoxy)-[[5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 23277438 |
| Molecular Formula | C22H26N3O9P |
| Molecular Weight | 507.44 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | methyl 2-[[(4-acetylphenoxy)-[[5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy]phosphoryl]amino]propanoate |
| SMILES | COC(=O)C(C)NP(=O)(OCC1C=CC(n2cc(C)c(=O)[nH]c2=O)O1)Oc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C22H26N3O9P/c1-13-11-25(22(29)23-20(13)27)19-10-9-18(33-19)12-32-35(30,24-14(2)21(28)31-4)34-17-7-5-16(6-8-17)15(3)26/h5-11,14,18-19H,12H2,1-4H3,(H,24,30)(H,23,27,29) |
| InChIKey | DVEUPGSIHZAUQL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 155.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|