C20H24N3O7PS — CID 11190835
methyl (2R)-2-[[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate (PubChem CID 11190835) has the molecular formula C20H24N3O7PS and a molecular weight of 481.47 g/mol. Its IUPAC name is methyl (2R)-2-[[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate.
| Compound Name | methyl (2R)-2-[[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 11190835 |
| Molecular Formula | C20H24N3O7PS |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | methyl (2R)-2-[[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
| SMILES | COC(=O)[C@@H](C)NP(=S)(OC[C@@H]1C=C[C@H](n2cc(C)c(=O)[nH]c2=O)O1)Oc1ccccc1 |
| InChI | InChI=1S/C20H24N3O7PS/c1-13-11-23(20(26)21-18(13)24)17-10-9-16(29-17)12-28-31(32,22-14(2)19(25)27-3)30-15-7-5-4-6-8-15/h4-11,14,16-17H,12H2,1-3H3,(H,22,32)(H,21,24,26)/t14-,16+,17-,31?/m1/s1 |
| InChIKey | BDIHVLJBORYFPF-NPAWJQJHSA-N |
| XLogP | 1.77 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|