C30H30N3O8P — CID 5481210
naphthalen-1-ylmethyl (2S)-2-[[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 5481210) has the molecular formula C30H30N3O8P and a molecular weight of 591.56 g/mol. Its IUPAC name is naphthalen-1-ylmethyl (2S)-2-[[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | naphthalen-1-ylmethyl (2S)-2-[[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 5481210 |
| Molecular Formula | C30H30N3O8P |
| Molecular Weight | 591.56 g/mol |
| Exact Mass | 591.18 |
| IUPAC Name | naphthalen-1-ylmethyl (2S)-2-[[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | Cc1cn([C@H]2C=C[C@@H](COP(=O)(N[C@@H](C)C(=O)OCc3cccc4ccccc34)Oc3ccccc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C30H30N3O8P/c1-20-17-33(30(36)31-28(20)34)27-16-15-25(40-27)19-39-42(37,41-24-12-4-3-5-13-24)32-21(2)29(35)38-18-23-11-8-10-22-9-6-7-14-26(22)23/h3-17,21,25,27H,18-19H2,1-2H3,(H,32,37)(H,31,34,36)/t21-,25-,27+,42?/m0/s1 |
| InChIKey | WJYVAUGSXQSMCW-LNGSPKHWSA-N |
| XLogP | 4.38 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|