C24H34N3O9P — CID 25262184
hexan-2-yl 2-[[[(2R,4R)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 25262184) has the molecular formula C24H34N3O9P and a molecular weight of 539.52 g/mol. Its IUPAC name is hexan-2-yl 2-[[[(2R,4R)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | hexan-2-yl 2-[[[(2R,4R)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 25262184 |
| Molecular Formula | C24H34N3O9P |
| Molecular Weight | 539.52 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | hexan-2-yl 2-[[[(2R,4R)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCCCC(C)OC(=O)C(C)NP(=O)(OC[C@@H]1OC[C@H](n2cc(C)c(=O)[nH]c2=O)O1)Oc1ccccc1 |
| InChI | InChI=1S/C24H34N3O9P/c1-5-6-10-17(3)34-23(29)18(4)26-37(31,36-19-11-8-7-9-12-19)33-15-21-32-14-20(35-21)27-13-16(2)22(28)25-24(27)30/h7-9,11-13,17-18,20-21H,5-6,10,14-15H2,1-4H3,(H,26,31)(H,25,28,30)/t17?,18?,20-,21-,37?/m1/s1 |
| InChIKey | YZJFCGGTJLPEHI-PSTPIHOFSA-N |
| XLogP | 3.02 |
| TPSA | 147.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|