C33H46N3O14P — CID 132579083
bis(3-methylbutyl) (2S)-2-[[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butanedioate (PubChem CID 132579083) has the molecular formula C33H46N3O14P and a molecular weight of 739.71 g/mol. Its IUPAC name is bis(3-methylbutyl) (2S)-2-[[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butanedioate.
| Compound Name | bis(3-methylbutyl) (2S)-2-[[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butanedioate |
|---|---|
| PubChem CID | 132579083 |
| Molecular Formula | C33H46N3O14P |
| Molecular Weight | 739.71 g/mol |
| Exact Mass | 739.27 |
| IUPAC Name | bis(3-methylbutyl) (2S)-2-[[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butanedioate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@@H](COP(=O)(N[C@@H](CC(=O)OCCC(C)C)C(=O)OCCC(C)C)Oc2ccccc2)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C33H46N3O14P/c1-20(2)13-16-44-28(40)18-25(32(41)45-17-14-21(3)4)35-51(43,50-24-10-8-7-9-11-24)46-19-26-29(47-22(5)37)30(48-23(6)38)31(49-26)36-15-12-27(39)34-33(36)42/h7-12,15,20-21,25-26,29-31H,13-14,16-19H2,1-6H3,(H,35,43)(H,34,39,42)/t25-,26+,29+,30+,31+,51?/m0/s1 |
| InChIKey | ZIHGZOYZKRNYPF-URSYGQDGSA-N |
| XLogP | 3.03 |
| TPSA | 216.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.71 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|