C23H32N3O10P — CID 118465878
butyl 2-[[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-3-(hydroxymethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 118465878) has the molecular formula C23H32N3O10P and a molecular weight of 541.49 g/mol. Its IUPAC name is butyl 2-[[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-3-(hydroxymethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | butyl 2-[[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-3-(hydroxymethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118465878 |
| Molecular Formula | C23H32N3O10P |
| Molecular Weight | 541.49 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | butyl 2-[[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-3-(hydroxymethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCCCOC(=O)C(C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1CO)Oc1ccccc1 |
| InChI | InChI=1S/C23H32N3O10P/c1-3-4-12-33-22(30)15(2)25-37(32,36-16-8-6-5-7-9-16)34-14-18-17(13-27)20(29)21(35-18)26-11-10-19(28)24-23(26)31/h5-11,15,17-18,20-21,27,29H,3-4,12-14H2,1-2H3,(H,25,32)(H,24,28,31)/t15?,17-,18-,20-,21-,37?/m1/s1 |
| InChIKey | ACPFIRPHZJCGCH-BRGNKJOKSA-N |
| XLogP | 0.93 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.49 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|