C23H31N6O9P — CID 51347377
butyl (2S)-2-[[[(2R,3S,4S,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 51347377) has the molecular formula C23H31N6O9P and a molecular weight of 566.51 g/mol. Its IUPAC name is butyl (2S)-2-[[[(2R,3S,4S,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | butyl (2S)-2-[[[(2R,3S,4S,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 51347377 |
| Molecular Formula | C23H31N6O9P |
| Molecular Weight | 566.51 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | butyl (2S)-2-[[[(2R,3S,4S,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCCCOC(=O)[C@H](C)NP(=O)(OC[C@@]1(N=[N+]=[N-])O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H](C)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C23H31N6O9P/c1-4-5-13-35-21(32)16(3)26-39(34,38-17-9-7-6-8-10-17)36-14-23(27-28-24)19(31)15(2)20(37-23)29-12-11-18(30)25-22(29)33/h6-12,15-16,19-20,31H,4-5,13-14H2,1-3H3,(H,26,34)(H,25,30,33)/t15-,16-,19-,20+,23+,39?/m0/s1 |
| InChIKey | HUMLCUPBVFNHGW-PXYJXFDOSA-N |
| XLogP | 2.59 |
| TPSA | 206.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|