C22H28N6O10P+ — CID 134518525
[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[(1-butoxy-1-oxopropan-2-yl)-phenoxyamino]-oxophosphanium (PubChem CID 134518525) has the molecular formula C22H28N6O10P+ and a molecular weight of 567.47 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[(1-butoxy-1-oxopropan-2-yl)-phenoxyamino]-oxophosphanium.
| Compound Name | [(2R,3S,4R,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[(1-butoxy-1-oxopropan-2-yl)-phenoxyamino]-oxophosphanium |
|---|---|
| PubChem CID | 134518525 |
| Molecular Formula | C22H28N6O10P+ |
| Molecular Weight | 567.47 g/mol |
| Exact Mass | 567.16 |
| IUPAC Name | [(2R,3S,4R,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[(1-butoxy-1-oxopropan-2-yl)-phenoxyamino]-oxophosphanium |
| SMILES | CCCCOC(=O)C(C)N(Oc1ccccc1)[P+](=O)OC[C@@]1(N=[N+]=[N-])O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H27N6O10P/c1-3-4-12-35-20(32)14(2)28(38-15-8-6-5-7-9-15)39(34)36-13-22(25-26-23)18(31)17(30)19(37-22)27-11-10-16(29)24-21(27)33/h5-11,14,17-19,30-31H,3-4,12-13H2,1-2H3/p+1/t14?,17-,18+,19-,22-/m1/s1 |
| InChIKey | MTHSDUGZOCTQMX-MSVHBDGXSA-O |
| XLogP | 1.50 |
| TPSA | 218.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.47 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|