C18H20FN6O9P+2 — CID 126713709
[(2R,3S,4S,5R)-2-[[[1-carboxyethyl(phenoxy)amino]-oxophosphaniumyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-3-fluoro-4-hydroxyoxolan-2-yl]imino-iminoazanium (PubChem CID 126713709) has the molecular formula C18H20FN6O9P+2 and a molecular weight of 514.36 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-2-[[[1-carboxyethyl(phenoxy)amino]-oxophosphaniumyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-3-fluoro-4-hydroxyoxolan-2-yl]imino-iminoazanium.
| Compound Name | [(2R,3S,4S,5R)-2-[[[1-carboxyethyl(phenoxy)amino]-oxophosphaniumyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-3-fluoro-4-hydroxyoxolan-2-yl]imino-iminoazanium |
|---|---|
| PubChem CID | 126713709 |
| Molecular Formula | C18H20FN6O9P+2 |
| Molecular Weight | 514.36 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | [(2R,3S,4S,5R)-2-[[[1-carboxyethyl(phenoxy)amino]-oxophosphaniumyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-3-fluoro-4-hydroxyoxolan-2-yl]imino-iminoazanium |
| SMILES | CC(C(=O)O)N(Oc1ccccc1)[P+](=O)OC[C@@]1(N=[N+]=N)O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1F |
| InChI | InChI=1S/C18H18FN6O9P/c1-10(16(28)29)25(34-11-5-3-2-4-6-11)35(31)32-9-18(22-23-20)14(19)13(27)15(33-18)24-8-7-12(26)21-17(24)30/h2-8,10,13-15,20,27H,9H2,1H3/p+2/t10?,13-,14+,15-,18-/m1/s1 |
| InChIKey | MBCHMQYZBNROLR-YNIFUKPGSA-P |
| XLogP | 0.45 |
| TPSA | 210.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.36 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|