C27H27N3O10P+ — CID 87644108
[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-oxo-[(1-oxo-1-phenylmethoxypropan-2-yl)-phenoxyamino]phosphanium (PubChem CID 87644108) has the molecular formula C27H27N3O10P+ and a molecular weight of 584.50 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-oxo-[(1-oxo-1-phenylmethoxypropan-2-yl)-phenoxyamino]phosphanium.
| Compound Name | [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-oxo-[(1-oxo-1-phenylmethoxypropan-2-yl)-phenoxyamino]phosphanium |
|---|---|
| PubChem CID | 87644108 |
| Molecular Formula | C27H27N3O10P+ |
| Molecular Weight | 584.50 g/mol |
| Exact Mass | 584.14 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-oxo-[(1-oxo-1-phenylmethoxypropan-2-yl)-phenoxyamino]phosphanium |
| SMILES | C#C[C@]1(CO[P+](=O)N(Oc2ccccc2)C(C)C(=O)OCc2ccccc2)O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H26N3O10P/c1-3-27(23(33)22(32)24(39-27)29-15-14-21(31)28-26(29)35)17-38-41(36)30(40-20-12-8-5-9-13-20)18(2)25(34)37-16-19-10-6-4-7-11-19/h1,4-15,18,22-24,32-33H,16-17H2,2H3/p+1/t18?,22-,23+,24-,27-/m1/s1 |
| InChIKey | JXABIHMMBMOLOD-DPXNDWLESA-O |
| XLogP | 1.26 |
| TPSA | 169.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.50 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|