C31H28ClN3O10P+ — CID 159430880
[4-(2-chloroethynyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[naphthalen-1-yloxy-(1-oxo-1-phenylmethoxypropan-2-yl)amino]-oxophosphanium (PubChem CID 159430880) has the molecular formula C31H28ClN3O10P+ and a molecular weight of 669.00 g/mol. Its IUPAC name is [4-(2-chloroethynyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[naphthalen-1-yloxy-(1-oxo-1-phenylmethoxypropan-2-yl)amino]-oxophosphanium.
| Compound Name | [4-(2-chloroethynyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[naphthalen-1-yloxy-(1-oxo-1-phenylmethoxypropan-2-yl)amino]-oxophosphanium |
|---|---|
| PubChem CID | 159430880 |
| Molecular Formula | C31H28ClN3O10P+ |
| Molecular Weight | 669.00 g/mol |
| Exact Mass | 668.12 |
| IUPAC Name | [4-(2-chloroethynyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[naphthalen-1-yloxy-(1-oxo-1-phenylmethoxypropan-2-yl)amino]-oxophosphanium |
| SMILES | CC(C(=O)OCc1ccccc1)N(Oc1cccc2ccccc12)[P+](=O)OCC1OC(n2ccc(=O)[nH]c2=O)C(O)(C#CCl)C1O |
| InChI | InChI=1S/C31H27ClN3O10P/c1-20(28(38)42-18-21-8-3-2-4-9-21)35(45-24-13-7-11-22-10-5-6-12-23(22)24)46(41)43-19-25-27(37)31(40,15-16-32)29(44-25)34-17-14-26(36)33-30(34)39/h2-14,17,20,25,27,29,37,40H,18-19H2,1H3/p+1 |
| InChIKey | JGQPDGOTNITVOF-UHFFFAOYSA-O |
| XLogP | 2.98 |
| TPSA | 169.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.00 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|