C22H26F3N3O9P+ — CID 87402219
[[1-(1,3-difluoropropan-2-yloxy)-1-oxopropan-2-yl]-phenoxyamino]-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]-oxophosphanium (PubChem CID 87402219) has the molecular formula C22H26F3N3O9P+ and a molecular weight of 564.43 g/mol. Its IUPAC name is [[1-(1,3-difluoropropan-2-yloxy)-1-oxopropan-2-yl]-phenoxyamino]-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]-oxophosphanium.
| Compound Name | [[1-(1,3-difluoropropan-2-yloxy)-1-oxopropan-2-yl]-phenoxyamino]-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]-oxophosphanium |
|---|---|
| PubChem CID | 87402219 |
| Molecular Formula | C22H26F3N3O9P+ |
| Molecular Weight | 564.43 g/mol |
| Exact Mass | 564.14 |
| IUPAC Name | [[1-(1,3-difluoropropan-2-yloxy)-1-oxopropan-2-yl]-phenoxyamino]-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]-oxophosphanium |
| SMILES | CC(C(=O)OC(CF)CF)N(Oc1ccccc1)[P+](=O)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(F)[C@@H]1O |
| InChI | InChI=1S/C22H25F3N3O9P/c1-13(19(31)35-15(10-23)11-24)28(37-14-6-4-3-5-7-14)38(33)34-12-16-18(30)22(2,25)20(36-16)27-9-8-17(29)26-21(27)32/h3-9,13,15-16,18,20,30H,10-12H2,1-2H3/p+1/t13?,16-,18-,20-,22-/m1/s1 |
| InChIKey | XFKPTJXKCMKEPO-ZCHHDDSOSA-O |
| XLogP | 1.73 |
| TPSA | 149.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|