C19H23FN4O8P+ — CID 134208592
[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-[1-carboxyethyl(phenoxy)amino]-oxophosphanium (PubChem CID 134208592) has the molecular formula C19H23FN4O8P+ and a molecular weight of 485.39 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-[1-carboxyethyl(phenoxy)amino]-oxophosphanium.
| Compound Name | [(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-[1-carboxyethyl(phenoxy)amino]-oxophosphanium |
|---|---|
| PubChem CID | 134208592 |
| Molecular Formula | C19H23FN4O8P+ |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-[1-carboxyethyl(phenoxy)amino]-oxophosphanium |
| SMILES | CC(C(=O)O)N(Oc1ccccc1)[P+](=O)OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@](C)(F)[C@@H]1O |
| InChI | InChI=1S/C19H22FN4O8P/c1-11(16(26)27)24(32-12-6-4-3-5-7-12)33(29)30-10-13-15(25)19(2,20)17(31-13)23-9-8-14(21)22-18(23)28/h3-9,11,13,15,17,25H,10H2,1-2H3,(H2-,21,22,26,27,28)/p+1/t11?,13-,15-,17-,19-/m1/s1 |
| InChIKey | FMWZJSDORFXBPU-PGRNDJKESA-O |
| XLogP | 1.26 |
| TPSA | 166.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|