C10H15FN3O6P — CID 24750913
[(2S,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methylphosphonic acid (PubChem CID 24750913) has the molecular formula C10H15FN3O6P and a molecular weight of 323.22 g/mol. Its IUPAC name is [(2S,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methylphosphonic acid.
| Compound Name | [(2S,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 24750913 |
| Molecular Formula | C10H15FN3O6P |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | [(2S,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methylphosphonic acid |
| SMILES | C[C@]1(F)[C@@H](O)[C@@H](CP(=O)(O)O)O[C@H]1n1ccc(N)nc1=O |
| InChI | InChI=1S/C10H15FN3O6P/c1-10(11)7(15)5(4-21(17,18)19)20-8(10)14-3-2-6(12)13-9(14)16/h2-3,5,7-8,15H,4H2,1H3,(H2,12,13,16)(H2,17,18,19)/t5-,7+,8-,10+/m1/s1 |
| InChIKey | XFPFTUKUHPQMPK-FDDSLVSWSA-N |
| XLogP | -1.01 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|