C32H34FN3O4P+ — CID 157172807
[(E)-4-[[(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]but-3-enyl]-triphenylphosphanium (PubChem CID 157172807) has the molecular formula C32H34FN3O4P+ and a molecular weight of 574.61 g/mol. Its IUPAC name is [(E)-4-[[(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]but-3-enyl]-triphenylphosphanium.
| Compound Name | [(E)-4-[[(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]but-3-enyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 157172807 |
| Molecular Formula | C32H34FN3O4P+ |
| Molecular Weight | 574.61 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | [(E)-4-[[(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]but-3-enyl]-triphenylphosphanium |
| SMILES | CC1(F)[C@H](O)[C@@H](CO/C=C/CC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)O[C@H]1n1ccc(N)nc1=O |
| InChI | InChI=1S/C32H33FN3O4P/c1-32(33)29(37)27(40-30(32)36-20-19-28(34)35-31(36)38)23-39-21-11-12-22-41(24-13-5-2-6-14-24,25-15-7-3-8-16-25)26-17-9-4-10-18-26/h2-11,13-21,27,29-30,37H,12,22-23H2,1H3,(H-,34,35,38)/p+1/b21-11+/t27-,29-,30-,32?/m1/s1 |
| InChIKey | KEQHDIITXHABSF-RCOAXKIASA-O |
| XLogP | 3.73 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.61 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|