C13H17F2N3O7 — CID 70392421
4-[[(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy]-4-hydroxybutanoic acid (PubChem CID 70392421) has the molecular formula C13H17F2N3O7 and a molecular weight of 365.29 g/mol. Its IUPAC name is 4-[[(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy]-4-hydroxybutanoic acid.
| Compound Name | 4-[[(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 70392421 |
| Molecular Formula | C13H17F2N3O7 |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 4-[[(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy]-4-hydroxybutanoic acid |
| SMILES | Nc1ccn([C@@H]2O[C@H](COC(O)CCC(=O)O)C(O)C2(F)F)c(=O)n1 |
| InChI | InChI=1S/C13H17F2N3O7/c14-13(15)10(22)6(5-24-9(21)2-1-8(19)20)25-11(13)18-4-3-7(16)17-12(18)23/h3-4,6,9-11,21-22H,1-2,5H2,(H,19,20)(H2,16,17,23)/t6-,9?,10?,11-/m1/s1 |
| InChIKey | WYZDABFRSMCARC-XLMFWOJCSA-N |
| XLogP | -1.08 |
| TPSA | 157.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|