C26H32N6O12P+ — CID 89266899
[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-[(1-ethoxy-1-oxopropan-2-yl)-phenoxyamino]-oxophosphanium (PubChem CID 89266899) has the molecular formula C26H32N6O12P+ and a molecular weight of 651.55 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-[(1-ethoxy-1-oxopropan-2-yl)-phenoxyamino]-oxophosphanium.
| Compound Name | [(2R,3S,4R,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-[(1-ethoxy-1-oxopropan-2-yl)-phenoxyamino]-oxophosphanium |
|---|---|
| PubChem CID | 89266899 |
| Molecular Formula | C26H32N6O12P+ |
| Molecular Weight | 651.55 g/mol |
| Exact Mass | 651.18 |
| IUPAC Name | [(2R,3S,4R,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-[(1-ethoxy-1-oxopropan-2-yl)-phenoxyamino]-oxophosphanium |
| SMILES | CCOC(=O)C(C)N(Oc1ccccc1)[P+](=O)OC[C@@]1(N=[N+]=[N-])O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](OC(=O)CC)[C@@H]1OC(=O)CC |
| InChI | InChI=1S/C26H31N6O12P/c1-5-19(34)41-21-22(42-20(35)6-2)26(29-30-27,43-23(21)31-14-13-18(33)28-25(31)37)15-40-45(38)32(16(4)24(36)39-7-3)44-17-11-9-8-10-12-17/h8-14,16,21-23H,5-7,15H2,1-4H3/p+1/t16?,21-,22+,23-,26-/m1/s1 |
| InChIKey | VVEWLBOYWZWSOO-GBLSHPAGSA-O |
| XLogP | 2.64 |
| TPSA | 230.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.55 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|