C17H16IN5O5 — CID 58078387
[(2R,4S,5S)-5-azido-2-(2,4-dioxopyrimidin-1-yl)-5-(iodomethyl)-4-methyloxolan-3-yl] benzoate (PubChem CID 58078387) has the molecular formula C17H16IN5O5 and a molecular weight of 497.25 g/mol. Its IUPAC name is [(2R,4S,5S)-5-azido-2-(2,4-dioxopyrimidin-1-yl)-5-(iodomethyl)-4-methyloxolan-3-yl] benzoate.
| Compound Name | [(2R,4S,5S)-5-azido-2-(2,4-dioxopyrimidin-1-yl)-5-(iodomethyl)-4-methyloxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 58078387 |
| Molecular Formula | C17H16IN5O5 |
| Molecular Weight | 497.25 g/mol |
| Exact Mass | 497.02 |
| IUPAC Name | [(2R,4S,5S)-5-azido-2-(2,4-dioxopyrimidin-1-yl)-5-(iodomethyl)-4-methyloxolan-3-yl] benzoate |
| SMILES | C[C@H]1C(OC(=O)c2ccccc2)[C@H](n2ccc(=O)[nH]c2=O)O[C@@]1(CI)N=[N+]=[N-] |
| InChI | InChI=1S/C17H16IN5O5/c1-10-13(27-15(25)11-5-3-2-4-6-11)14(28-17(10,9-18)21-22-19)23-8-7-12(24)20-16(23)26/h2-8,10,13-14H,9H2,1H3,(H,20,24,26)/t10-,13?,14+,17+/m0/s1 |
| InChIKey | ZDXCUCJSSGBIIJ-ZVPYPMHXSA-N |
| XLogP | 2.37 |
| TPSA | 139.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|