C9H9FIN5O4 — CID 54768899
1-[(2R,3S,4R,5S)-5-azido-3-fluoro-4-hydroxy-5-(iodomethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 54768899) has the molecular formula C9H9FIN5O4 and a molecular weight of 397.10 g/mol. Its IUPAC name is 1-[(2R,3S,4R,5S)-5-azido-3-fluoro-4-hydroxy-5-(iodomethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,4R,5S)-5-azido-3-fluoro-4-hydroxy-5-(iodomethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 54768899 |
| Molecular Formula | C9H9FIN5O4 |
| Molecular Weight | 397.10 g/mol |
| Exact Mass | 396.97 |
| IUPAC Name | 1-[(2R,3S,4R,5S)-5-azido-3-fluoro-4-hydroxy-5-(iodomethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | [N-]=[N+]=N[C@]1(CI)O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H](F)[C@@H]1O |
| InChI | InChI=1S/C9H9FIN5O4/c10-5-6(18)9(3-11,14-15-12)20-7(5)16-2-1-4(17)13-8(16)19/h1-2,5-7,18H,3H2,(H,13,17,19)/t5-,6-,7+,9+/m0/s1 |
| InChIKey | OTQPSDNWRVYTBH-XZMZPDFPSA-N |
| XLogP | 0.21 |
| TPSA | 133.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.10 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|