C9H9F2N5O5 — CID 175678243
1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 175678243) has the molecular formula C9H9F2N5O5 and a molecular weight of 305.20 g/mol. Its IUPAC name is 1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 175678243 |
| Molecular Formula | C9H9F2N5O5 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | [N-]=[N+]=N[C@]1(CO)O[C@@H](n2cc(F)c(=O)[nH]c2=O)[C@@H](F)[C@@H]1O |
| InChI | InChI=1S/C9H9F2N5O5/c10-3-1-16(8(20)13-6(3)19)7-4(11)5(18)9(2-17,21-7)14-15-12/h1,4-5,7,17-18H,2H2,(H,13,19,20)/t4-,5-,7+,9+/m0/s1 |
| InChIKey | GSPRFEKQVIAWRL-BWDYXRCQSA-N |
| XLogP | -1.10 |
| TPSA | 153.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|