C18H24N6O8 — CID 91509156
[(2S,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-di(propanoyloxy)oxolan-2-yl]methyl propanoate (PubChem CID 91509156) has the molecular formula C18H24N6O8 and a molecular weight of 452.42 g/mol. Its IUPAC name is [(2S,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-di(propanoyloxy)oxolan-2-yl]methyl propanoate.
| Compound Name | [(2S,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-di(propanoyloxy)oxolan-2-yl]methyl propanoate |
|---|---|
| PubChem CID | 91509156 |
| Molecular Formula | C18H24N6O8 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | [(2S,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-di(propanoyloxy)oxolan-2-yl]methyl propanoate |
| SMILES | CCC(=O)OC[C@]1(N=[N+]=[N-])OC(n2ccc(N)nc2=O)[C@H](OC(=O)CC)C1OC(=O)CC |
| InChI | InChI=1S/C18H24N6O8/c1-4-11(25)29-9-18(22-23-20)15(31-13(27)6-3)14(30-12(26)5-2)16(32-18)24-8-7-10(19)21-17(24)28/h7-8,14-16H,4-6,9H2,1-3H3,(H2,19,21,28)/t14-,15?,16?,18+/m1/s1 |
| InChIKey | JVZYJCGZYASVTF-IDMDMSBLSA-N |
| XLogP | 0.96 |
| TPSA | 197.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|