C14H20N6O6 — CID 175678131
[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methyl pentanoate (PubChem CID 175678131) has the molecular formula C14H20N6O6 and a molecular weight of 368.35 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methyl pentanoate.
| Compound Name | [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methyl pentanoate |
|---|---|
| PubChem CID | 175678131 |
| Molecular Formula | C14H20N6O6 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methyl pentanoate |
| SMILES | CCCCC(=O)OC[C@@]1(N=[N+]=[N-])O[C@@H](n2ccc(N)nc2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H20N6O6/c1-2-3-4-9(21)25-7-14(18-19-16)11(23)10(22)12(26-14)20-6-5-8(15)17-13(20)24/h5-6,10-12,22-23H,2-4,7H2,1H3,(H2,15,17,24)/t10-,11+,12-,14-/m1/s1 |
| InChIKey | KBZMLVHFDNNTGZ-GFQSEFKGSA-N |
| XLogP | -0.18 |
| TPSA | 185.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|