C18H28N6O7 — CID 141242732
octyl N-[1-[(2R,3S,4S,5R)-5-azido-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate (PubChem CID 141242732) has the molecular formula C18H28N6O7 and a molecular weight of 440.46 g/mol. Its IUPAC name is octyl N-[1-[(2R,3S,4S,5R)-5-azido-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | octyl N-[1-[(2R,3S,4S,5R)-5-azido-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 141242732 |
| Molecular Formula | C18H28N6O7 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | octyl N-[1-[(2R,3S,4S,5R)-5-azido-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate |
| SMILES | CCCCCCCCOC(=O)Nc1ccn([C@@H]2O[C@@](CO)(N=[N+]=[N-])[C@@H](O)[C@@H]2O)c(=O)n1 |
| InChI | InChI=1S/C18H28N6O7/c1-2-3-4-5-6-7-10-30-17(29)21-12-8-9-24(16(28)20-12)15-13(26)14(27)18(11-25,31-15)22-23-19/h8-9,13-15,25-27H,2-7,10-11H2,1H3,(H,20,21,28,29)/t13-,14-,15+,18+/m0/s1 |
| InChIKey | FVTCUZIEHDNKJJ-OIPACUDHSA-N |
| XLogP | 1.40 |
| TPSA | 191.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|