C16H22N4O7 — CID 165408700
pentyl N-[1-[(2R,5R)-2-cyano-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate (PubChem CID 165408700) has the molecular formula C16H22N4O7 and a molecular weight of 382.37 g/mol. Its IUPAC name is pentyl N-[1-[(2R,5R)-2-cyano-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | pentyl N-[1-[(2R,5R)-2-cyano-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 165408700 |
| Molecular Formula | C16H22N4O7 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | pentyl N-[1-[(2R,5R)-2-cyano-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate |
| SMILES | CCCCCOC(=O)Nc1ccn([C@]2(C#N)O[C@H](CO)C(O)C2O)c(=O)n1 |
| InChI | InChI=1S/C16H22N4O7/c1-2-3-4-7-26-15(25)19-11-5-6-20(14(24)18-11)16(9-17)13(23)12(22)10(8-21)27-16/h5-6,10,12-13,21-23H,2-4,7-8H2,1H3,(H,18,19,24,25)/t10-,12?,13?,16-/m1/s1 |
| InChIKey | JWXSVJCXXDPYQW-VHBSBENZSA-N |
| XLogP | -0.73 |
| TPSA | 166.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|