C19H24N4O6 — CID 172874234
[5-(4-amino-5-ethynyl-2-oxopyrimidin-1-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl heptanoate (PubChem CID 172874234) has the molecular formula C19H24N4O6 and a molecular weight of 404.42 g/mol. Its IUPAC name is [5-(4-amino-5-ethynyl-2-oxopyrimidin-1-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl heptanoate.
| Compound Name | [5-(4-amino-5-ethynyl-2-oxopyrimidin-1-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl heptanoate |
|---|---|
| PubChem CID | 172874234 |
| Molecular Formula | C19H24N4O6 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | [5-(4-amino-5-ethynyl-2-oxopyrimidin-1-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl heptanoate |
| SMILES | C#Cc1cn(C2(C#N)OC(COC(=O)CCCCCC)C(O)C2O)c(=O)nc1N |
| InChI | InChI=1S/C19H24N4O6/c1-3-5-6-7-8-14(24)28-10-13-15(25)16(26)19(11-20,29-13)23-9-12(4-2)17(21)22-18(23)27/h2,9,13,15-16,25-26H,3,5-8,10H2,1H3,(H2,21,22,27) |
| InChIKey | BBXJPIZHJPRABV-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 160.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|