C26H48O8 — CID 101270280
[(2R,3S,4S,5R)-5-(decanoyloxymethyl)-3,4,5-trihydroxyoxolan-2-yl]methyl decanoate (PubChem CID 101270280) has the molecular formula C26H48O8 and a molecular weight of 488.66 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-(decanoyloxymethyl)-3,4,5-trihydroxyoxolan-2-yl]methyl decanoate.
| Compound Name | [(2R,3S,4S,5R)-5-(decanoyloxymethyl)-3,4,5-trihydroxyoxolan-2-yl]methyl decanoate |
|---|---|
| PubChem CID | 101270280 |
| Molecular Formula | C26H48O8 |
| Molecular Weight | 488.66 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | [(2R,3S,4S,5R)-5-(decanoyloxymethyl)-3,4,5-trihydroxyoxolan-2-yl]methyl decanoate |
| SMILES | CCCCCCCCCC(=O)OC[C@H]1O[C@](O)(COC(=O)CCCCCCCCC)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H48O8/c1-3-5-7-9-11-13-15-17-22(27)32-19-21-24(29)25(30)26(31,34-21)20-33-23(28)18-16-14-12-10-8-6-4-2/h21,24-25,29-31H,3-20H2,1-2H3/t21-,24-,25+,26-/m1/s1 |
| InChIKey | HNIFZUCWKMWKSF-ATPOPXNDSA-N |
| XLogP | 4.16 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.66 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|