C12H16N6O6 — CID 22593593
N-[1-[5-azido-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]propanamide (PubChem CID 22593593) has the molecular formula C12H16N6O6 and a molecular weight of 340.30 g/mol. Its IUPAC name is N-[1-[5-azido-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]propanamide.
| Compound Name | N-[1-[5-azido-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]propanamide |
|---|---|
| PubChem CID | 22593593 |
| Molecular Formula | C12H16N6O6 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | N-[1-[5-azido-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]propanamide |
| SMILES | CCC(=O)Nc1ccn(C2OC(CO)(N=[N+]=[N-])C(O)C2O)c(=O)n1 |
| InChI | InChI=1S/C12H16N6O6/c1-2-7(20)14-6-3-4-18(11(23)15-6)10-8(21)9(22)12(5-19,24-10)16-17-13/h3-4,8-10,19,21-22H,2,5H2,1H3,(H,14,15,20,23) |
| InChIKey | GMABCKAFUBHVNG-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 182.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|