C12H18FN7O4 — CID 175678149
4-(3-aminopropylamino)-1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 175678149) has the molecular formula C12H18FN7O4 and a molecular weight of 343.32 g/mol. Its IUPAC name is 4-(3-aminopropylamino)-1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-(3-aminopropylamino)-1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 175678149 |
| Molecular Formula | C12H18FN7O4 |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 4-(3-aminopropylamino)-1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | [N-]=[N+]=N[C@]1(CO)O[C@@H](n2ccc(NCCCN)nc2=O)[C@@H](F)[C@@H]1O |
| InChI | InChI=1S/C12H18FN7O4/c13-8-9(22)12(6-21,18-19-15)24-10(8)20-5-2-7(17-11(20)23)16-4-1-3-14/h2,5,8-10,21-22H,1,3-4,6,14H2,(H,16,17,23)/t8-,9-,10+,12+/m0/s1 |
| InChIKey | LBGKXIVIXQSBJG-UXCLJVHYSA-N |
| XLogP | -0.77 |
| TPSA | 171.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|