C15H19FN6O6 — CID 56967276
methyl (2S)-1-[1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]pyrrolidine-2-carboxylate (PubChem CID 56967276) has the molecular formula C15H19FN6O6 and a molecular weight of 398.35 g/mol. Its IUPAC name is methyl (2S)-1-[1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 56967276 |
| Molecular Formula | C15H19FN6O6 |
| Molecular Weight | 398.35 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | methyl (2S)-1-[1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1c1ccn([C@@H]2O[C@@](CO)(N=[N+]=[N-])[C@@H](O)[C@@H]2F)c(=O)n1 |
| InChI | InChI=1S/C15H19FN6O6/c1-27-13(25)8-3-2-5-21(8)9-4-6-22(14(26)18-9)12-10(16)11(24)15(7-23,28-12)19-20-17/h4,6,8,10-12,23-24H,2-3,5,7H2,1H3/t8-,10-,11-,12+,15+/m0/s1 |
| InChIKey | GPTKQVZBRQDQMZ-YLYWLHNCSA-N |
| XLogP | -0.39 |
| TPSA | 162.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.35 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|