C21H22FN7O6 — CID 56967104
methyl (2S)-2-[[1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino]-3-(1H-indol-2-yl)propanoate (PubChem CID 56967104) has the molecular formula C21H22FN7O6 and a molecular weight of 487.45 g/mol. Its IUPAC name is methyl (2S)-2-[[1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino]-3-(1H-indol-2-yl)propanoate.
| Compound Name | methyl (2S)-2-[[1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino]-3-(1H-indol-2-yl)propanoate |
|---|---|
| PubChem CID | 56967104 |
| Molecular Formula | C21H22FN7O6 |
| Molecular Weight | 487.45 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | methyl (2S)-2-[[1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]amino]-3-(1H-indol-2-yl)propanoate |
| SMILES | COC(=O)[C@H](Cc1cc2ccccc2[nH]1)Nc1ccn([C@@H]2O[C@@](CO)(N=[N+]=[N-])[C@@H](O)[C@@H]2F)c(=O)n1 |
| InChI | InChI=1S/C21H22FN7O6/c1-34-19(32)14(9-12-8-11-4-2-3-5-13(11)24-12)25-15-6-7-29(20(33)26-15)18-16(22)17(31)21(10-30,35-18)27-28-23/h2-8,14,16-18,24,30-31H,9-10H2,1H3,(H,25,26,33)/t14-,16-,17-,18+,21+/m0/s1 |
| InChIKey | BLXQXIWFBPOOOH-MOMZRRJVSA-N |
| XLogP | 1.15 |
| TPSA | 187.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.45 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|