C19H17FN6O4 — CID 86567821
1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(naphthalen-1-ylamino)pyrimidin-2-one (PubChem CID 86567821) has the molecular formula C19H17FN6O4 and a molecular weight of 412.38 g/mol. Its IUPAC name is 1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(naphthalen-1-ylamino)pyrimidin-2-one.
| Compound Name | 1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(naphthalen-1-ylamino)pyrimidin-2-one |
|---|---|
| PubChem CID | 86567821 |
| Molecular Formula | C19H17FN6O4 |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 1-[(2R,3S,4R,5R)-5-azido-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(naphthalen-1-ylamino)pyrimidin-2-one |
| SMILES | [N-]=[N+]=N[C@]1(CO)O[C@@H](n2ccc(Nc3cccc4ccccc34)nc2=O)[C@@H](F)[C@@H]1O |
| InChI | InChI=1S/C19H17FN6O4/c20-15-16(28)19(10-27,24-25-21)30-17(15)26-9-8-14(23-18(26)29)22-13-7-3-5-11-4-1-2-6-12(11)13/h1-9,15-17,27-28H,10H2,(H,22,23,29)/t15-,16-,17+,19+/m0/s1 |
| InChIKey | JDUZTGAYHNJOEU-IMBTUZDBSA-N |
| XLogP | 2.37 |
| TPSA | 145.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|